Compound Q&A

What are the physical and chemical properties of Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6)?

Answer

Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate
Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) is a crystalline compound with a molecular weight of approximately 262.32 g/mol. It has a low solubility in water but good solubility in organic solvents. The compound is moderately reactive, showing some tendency towards hydrolysis under basic conditions. It can form stable crystalline forms under standard laboratory conditions.

About

CAS No 79247-72-6
English Name Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate
Molecular Formula C10H15NO2S
Molecular Weight 213.3 g/mol
SMILES CCOC(=O)C1=NC(=CS1)C(C)(C)C
InChIKey DCHMVIBNJJRJQS-UHFFFAOYSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) typically synthesized?

Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) is typically synthesized ...

Compound Q&A

What industries use Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6)?

Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6) is used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6)?

When handling Ethyl 4-(2-methyl-2-propanyl)-1,3-thiazole-2-carboxylate (CAS: 79247-72-6), laboratory...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...