Compound Q&A

What precautions should be taken when handling 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6)?

Answer

2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose
When handling this compound, wear appropriate personal protective equipment (PPE), including gloves and eye protection. Store it in a well-ventilated area and keep away from heat sources. In case of a spill, use appropriate spill kits and immediately refer to the Safety Data Sheet (SDS) for further instructions. Always ensure proper fume hood use during handling.

About

English Name 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose
Molecular Formula C22H22O11
Molecular Weight 462.4 g/mol
SMILES c1ccc(cc1)/C=C/C(=O)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC(=O)c3cc(c(c(c3)O)O)O)CO)O)O
InChIKey FISMJUPMCGKNNX-PCGJYRBUSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6)?

The compound has a crystalline form with a molecular weight of approximately 604.5 g/mol. It is spar...

Compound Q&A

How is 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6) typically synthesized?

The compound is synthesized through a multi-step process involving the coupling of a phenylacetyl ch...

Compound Q&A

What industries use 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6)?

This compound is primarily used in pharmaceuticals for its potential as a bioactive molecule. It als...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...