Compound Q&A

What are the physical and chemical properties of 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6)?

Answer

2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose
The compound has a crystalline form with a molecular weight of approximately 604.5 g/mol. It is sparingly soluble in water and ethanol. Chemically, it is reactive towards nucleophiles and can undergo ester hydrolysis under acidic conditions. It also displays good stability under neutral and slightly basic conditions.

About

English Name 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose
Molecular Formula C22H22O11
Molecular Weight 462.4 g/mol
SMILES c1ccc(cc1)/C=C/C(=O)O[C@@H]2[C@H]([C@@H]([C@H](O[C@H]2OC(=O)c3cc(c(c(c3)O)O)O)CO)O)O
InChIKey FISMJUPMCGKNNX-PCGJYRBUSA-N
Last Updated: 2026-01-01 01:49

Related Q&A

Compound Q&A

How is 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6) typically synthesized?

The compound is synthesized through a multi-step process involving the coupling of a phenylacetyl ch...

Compound Q&A

What industries use 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6)?

This compound is primarily used in pharmaceuticals for its potential as a bioactive molecule. It als...

Compound Q&A

What precautions should be taken when handling 2-O-[(2E)-3-Phenyl-2-propenoyl]-1-O-(3,4,5-trihydroxybenzoyl)-beta-D-glucopyranose (CAS: 791836-69-6)?

When handling this compound, wear appropriate personal protective equipment (PPE), including gloves ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...