Compound Q&A

What precautions should be taken when handling 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0)?

Answer

1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone
When handling 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone, it is essential to wear protective equipment such as gloves, goggles, and a laboratory coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up carefully, and appropriate safety data sheets (SDS) should be consulted for detailed instructions. Ensure proper storage in a secure, cool, and dry location to prevent degradation and reactivity with other chemicals.

About

CAS No 63335-24-0
English Name 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone
Molecular Formula C21H26O4
Molecular Weight 342.4349999999999 g/mol
SMILES c1cc(c(c(c1)O)C(=O)CCCCCCCCc2ccc(cc2)O)O
InChIKey KOAPDMKKECXPHX-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0)?

1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone is a crystalline compound with a molecular we...

Compound Q&A

How is 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0) typically synthesized?

1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone is commonly synthesized through a multistep p...

Compound Q&A

What industries use 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0)?

1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone is primarily used in the pharmaceutical indus...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...