Compound Q&A

What are the physical and chemical properties of 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0)?

Answer

1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone
1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone is a crystalline compound with a molecular weight of approximately 318.2 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and dichloromethane. The compound exhibits good stability under normal conditions but can react with strong acids and bases. It is insoluble in air and may react with oxygen to form undesirable products.

About

CAS No 63335-24-0
English Name 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone
Molecular Formula C21H26O4
Molecular Weight 342.4349999999999 g/mol
SMILES c1cc(c(c(c1)O)C(=O)CCCCCCCCc2ccc(cc2)O)O
InChIKey KOAPDMKKECXPHX-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0) typically synthesized?

1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone is commonly synthesized through a multistep p...

Compound Q&A

What industries use 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0)?

1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone (CAS: 63335-24-0)?

When handling 1-(2,6-Dihydroxyphenyl)-9-(4-hydroxyphenyl)-1-nonanone, it is essential to wear protec...

Compound Q&A

How is [3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 1704069-27-1) typically synthesized?

[3-(1-Pyrrolidinylsulfonyl)-4-(trifluoromethoxy)phenyl]boronic acid (CAS: 170406...

1704069-27-1[3-(1-Pyrrolidinylsu...
Compound Q&A

What industries use 2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5)?

2-Chlorodibenzo[b,f]oxepin-10(11H)-one (CAS: 55595-54-5) is used in the pharmace...

55595-54-52-Chlorodibenzo[b,f]...
Compound Q&A

What is 3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane (CAS: 160172-46-3)?

3-[(Dimethylsilyl)oxy]-1,1,5,5-tetramethyl-3-vinyltrisiloxane is an organosilico...

160172-46-33-[(Dimethylsilyl)ox...
Compound Q&A

How should waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 871332-71-7) be handled?

Waste containing [4-Chloro-3-(4-morpholinylcarbonyl)phenyl]boronic acid (CAS: 87...

871332-71-7[4-Chloro-3-(4-morph...