Compound Q&A

What are the physical and chemical properties of Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9)?

Answer

Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate
Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9) is a white crystalline solid with a molecular weight of approximately 221.25 g/mol. It has a low solubility in water but is soluble in common organic solvents like methanol, ethanol, and acetonitrile. The compound is relatively stable under normal conditions but may react with strong acids or bases. It is used in the synthesis of various chemical intermediates and pharmaceuticals.

About

English Name Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate
Molecular Formula C10H10N2O2
Molecular Weight 190.2 g/mol
SMILES O=C(C1=C(C)N=C(NC=C2)C2=C1)OC
InChIKey LHAHLXKZWRIQNR-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9) typically synthesized?

Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9) is typically synthesized ...

Compound Q&A

What industries use Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9)?

Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9) is primarily used in the ...

Compound Q&A

What precautions should be taken when handling Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9)?

When handling Methyl 6-methyl-1H-pyrrolo[2,3-b]pyridine-5-carboxylate (CAS: 872355-54-9), it is impo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...