Compound Q&A

What industries use Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8)?

Answer

Methyl beta,beta-difluorophenylalaninate hydrochloride (1:1)
Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8) is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of certain bioactive compounds. It is also used in the production of polymers, sensors, and semiconductors due to its unique chemical structure. Additionally, it finds applications in the field of organic chemistry as a useful reagent in various synthetic transformations.

About

CAS No 75149-43-8
English Name Methyl beta,beta-difluorophenylalaninate hydrochloride (1:1)
Molecular Formula C10H12ClF2NO2
Molecular Weight 251.66 g/mol
SMILES O=C(OC)C(N)C(F)(F)C1=CC=CC=C1.[H]Cl
InChIKey IUYXCBNVVDUGBZ-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8)?

Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8) is a crystalline compound w...

Compound Q&A

How is Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8) typically synthesized?

Methyl beta,beta-difluorophenylalaninate hydrochloride is typically synthesized by the esterificatio...

Compound Q&A

What precautions should be taken when handling Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8)?

When handling Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...