Compound Q&A

How is Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8) typically synthesized?

Answer

Methyl beta,beta-difluorophenylalaninate hydrochloride (1:1)
Methyl beta,beta-difluorophenylalaninate hydrochloride is typically synthesized by the esterification of beta,beta-difluorophenylalanine with methyl alcohol in the presence of a catalytic amount of an acid, such as sulfuric acid. The reaction is usually carried out under mild conditions, and the product is then neutralized with a base to form the hydrochloride salt. The reaction yields are generally good, and the product can be isolated by recrystallization.

About

CAS No 75149-43-8
English Name Methyl beta,beta-difluorophenylalaninate hydrochloride (1:1)
Molecular Formula C10H12ClF2NO2
Molecular Weight 251.66 g/mol
SMILES O=C(OC)C(N)C(F)(F)C1=CC=CC=C1.[H]Cl
InChIKey IUYXCBNVVDUGBZ-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8)?

Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8) is a crystalline compound w...

Compound Q&A

What industries use Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8)?

Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8) is used in various industri...

Compound Q&A

What precautions should be taken when handling Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8)?

When handling Methyl beta,beta-difluorophenylalaninate hydrochloride (CAS: 75149-43-8), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...