Compound Q&A

What industries use threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8)?

Answer

threo-Guaiacylglycerol beta-coniferyl ether
Threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) is primarily used in the pharmaceutical and natural product chemistry industries. It is also explored for its potential applications in the production of lignin-based materials and as a component in the development of new polymer materials. Its unique chemical structure makes it a valuable intermediate in various organic synthesis processes.

About

English Name threo-Guaiacylglycerol beta-coniferyl ether
Molecular Formula C20H24O7
Molecular Weight 376.4004 g/mol
SMILES COC1=C(C=CC(=C1)C=CCO)OC(CO)C(C2=CC(=C(C=C2)O)OC)O
InChIKey FYEZJIXULOZDRT-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8)?

Threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) is a crystalline compound with a mole...

Compound Q&A

How is threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) typically synthesized?

Threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) can be synthesized through a condensa...

Compound Q&A

What precautions should be taken when handling threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8)?

When handling threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8), it is important to use...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...