Compound Q&A

What are the physical and chemical properties of threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8)?

Answer

threo-Guaiacylglycerol beta-coniferyl ether
Threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) is a crystalline compound with a molecular weight of approximately 315.24 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and methanol. Chemically, it is relatively stable under normal conditions but can react with strong acids or bases. It is often used in the synthesis of lignin derivatives and has potential applications in natural product chemistry.

About

English Name threo-Guaiacylglycerol beta-coniferyl ether
Molecular Formula C20H24O7
Molecular Weight 376.4 g/mol
SMILES COC1=C(C=CC(=C1)C=CCO)OC(CO)C(C2=CC(=C(C=C2)O)OC)O
InChIKey FYEZJIXULOZDRT-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) typically synthesized?

Threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) can be synthesized through a condensa...

Compound Q&A

What industries use threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8)?

Threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8) is primarily used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8)?

When handling threo-Guaiacylglycerol beta-coniferyl ether (CAS: 869799-76-8), it is important to use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...