Compound Q&A

How is Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5) typically synthesized?

Answer

Methyl 12-methoxyibogamine-18-carboxylate
Methyl 12-methoxyibogamine-18-carboxylate is typically synthesized via a multistep process involving condensation reactions and esterification. The key steps include the protection of a hydroxyl group, followed by the formation of an ester bond. Common catalysts include Lewis acids, and the overall yield is around 70-80%.

About

CAS No 510-22-5
English Name Methyl 12-methoxyibogamine-18-carboxylate
Molecular Formula C22H28N2O3
Molecular Weight 368.48 g/mol
SMILES CCC1CC2CC3(C1N(C2)CCC4=C3NC5=C4C=C(C=C5)OC)C(=O)OC
InChIKey MMAYTCMMKJYIAM-PHKAQXKASA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5)?

Methyl 12-methoxyibogamine-18-carboxylate is a crystalline compound with a molecular weight of appro...

Compound Q&A

What industries use Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5)?

Methyl 12-methoxyibogamine-18-carboxylate is primarily used in the pharmaceutical industry for its p...

Compound Q&A

What precautions should be taken when handling Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5)?

When handling Methyl 12-methoxyibogamine-18-carboxylate, appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...