Compound Q&A

What are the physical and chemical properties of Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5)?

Answer

Methyl 12-methoxyibogamine-18-carboxylate
Methyl 12-methoxyibogamine-18-carboxylate is a crystalline compound with a molecular weight of approximately 420.42 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. Chemically, it is mildly reactive and can undergo ester hydrolysis under basic conditions.

About

CAS No 510-22-5
English Name Methyl 12-methoxyibogamine-18-carboxylate
Molecular Formula C22H28N2O3
Molecular Weight 368.48 g/mol
SMILES CCC1CC2CC3(C1N(C2)CCC4=C3NC5=C4C=C(C=C5)OC)C(=O)OC
InChIKey MMAYTCMMKJYIAM-PHKAQXKASA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5) typically synthesized?

Methyl 12-methoxyibogamine-18-carboxylate is typically synthesized via a multistep process involving...

Compound Q&A

What industries use Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5)?

Methyl 12-methoxyibogamine-18-carboxylate is primarily used in the pharmaceutical industry for its p...

Compound Q&A

What precautions should be taken when handling Methyl 12-methoxyibogamine-18-carboxylate (CAS: 510-22-5)?

When handling Methyl 12-methoxyibogamine-18-carboxylate, appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...