Compound Q&A

What industries use 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2)?

Answer

2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride
2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride is used in the pharmaceutical industry for the synthesis of complex organic molecules, in polymer chemistry for the modification of functional groups, and in semiconductor and sensor technologies for its unique electronic and chemical properties.

About

English Name 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C7H3ClF4O2S
Molecular Weight 262.61 g/mol
SMILES Fc1cccc(c1S(=O)(=O)Cl)C(F)(F)F
InChIKey VVCAQQGQZZLRJK-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2)?

2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride is a crystalline solid with a molecular weight ...

Compound Q&A

How is 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2) typically synthesized?

2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride is typically synthesized via the chlorosulfonyl...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2)?

When handling 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...