Compound Q&A

What are the physical and chemical properties of 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2)?

Answer

2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride
2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride is a crystalline solid with a molecular weight of approximately 323.09 g/mol. It is poorly soluble in water but soluble in organic solvents like dichloromethane and acetonitrile. This compound is highly reactive, particularly towards nucleophiles and bases, making it a key reagent in organic synthesis.

About

English Name 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride
Molecular Formula C7H3ClF4O2S
Molecular Weight 262.61 g/mol
SMILES Fc1cccc(c1S(=O)(=O)Cl)C(F)(F)F
InChIKey VVCAQQGQZZLRJK-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2) typically synthesized?

2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride is typically synthesized via the chlorosulfonyl...

Compound Q&A

What industries use 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2)?

2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride is used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride (CAS: 405264-04-2)?

When handling 2-Fluoro-6-(trifluoromethyl)benzenesulfonyl chloride, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...