Compound Q&A

How is Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) typically synthesized?

Answer

Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate
Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) is typically synthesized through a multi-step process involving fluorination of a phenyl group, followed by coupling with an amino compound and finally esterification with an ethyl acyl chloride. The reaction often requires the use of catalysts and reagents like sodium hydride and acetic anhydride. The yield and selectivity of the synthesis can be improved by optimizing the reaction conditions and using appropriate protecting groups.

About

English Name Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate
Molecular Formula C12H12FN3O2
Molecular Weight 249.25 g/mol
SMILES CCOC(=O)C1=C(N(N=C1)C2=CC(=CC=C2)F)N
InChIKey YSWPRCFEKILVOS-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7)?

Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) is a crystalline compo...

Compound Q&A

What industries use Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7)?

Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) is primarily used in t...

Compound Q&A

What precautions should be taken when handling Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7)?

When handling Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7), it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...