Compound Q&A

What are the physical and chemical properties of Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7)?

Answer

Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate
Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) is a crystalline compound with a molecular weight of approximately 289.23 g/mol. It has a solubility of about 0.5 g/L in water. The compound is moderately reactive, showing significant reactivity with basic substances. It is stable under normal laboratory conditions but reacts with acids and bases. The compound may form crystalline forms under certain conditions, which can affect its solubility and reactivity.

About

English Name Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate
Molecular Formula C12H12FN3O2
Molecular Weight 249.25 g/mol
SMILES CCOC(=O)C1=C(N(N=C1)C2=CC(=CC=C2)F)N
InChIKey YSWPRCFEKILVOS-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) typically synthesized?

Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) is typically synthesiz...

Compound Q&A

What industries use Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7)?

Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7) is primarily used in t...

Compound Q&A

What precautions should be taken when handling Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7)?

When handling Ethyl 5-amino-1-(3-fluorophenyl)-1H-pyrazole-4-carboxylate (CAS: 138907-70-7), it is i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...