Compound Q&A

What precautions should be taken when handling 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1)?

Answer

4-Formyl-1,3-benzenedisulfonic acid
When handling 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The compound should be handled in a well-ventilated area or fume hood due to its volatility and potential for inhalation. Spills should be cleaned up using appropriate chemical spill kits, and the Material Safety Data Sheet (MSDS/SDS) should be consulted for detailed emergency procedures.

About

CAS No 88-39-1
English Name 4-Formyl-1,3-benzenedisulfonic acid
Molecular Formula C7H6O7S2
Molecular Weight 266.25 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)C=O
InChIKey PQYVGRGYAZDHFY-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1)?

4-Formyl-1,3-benzenedisulfonic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1) typically synthesized?

4-Formyl-1,3-benzenedisulfonic acid is typically synthesized by the sulfonation of 1,3-benzenedicarb...

Compound Q&A

What industries use 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1)?

4-Formyl-1,3-benzenedisulfonic acid is used in various industries. It is a key component in the prod...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...