Compound Q&A

What are the physical and chemical properties of 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1)?

Answer

4-Formyl-1,3-benzenedisulfonic acid
4-Formyl-1,3-benzenedisulfonic acid is a crystalline solid with a molecular weight of approximately 222.13 g/mol. It is soluble in water and less soluble in organic solvents. Chemically, it is highly reactive due to the presence of the carboxyl and sulfonic acid groups, which can participate in various chemical reactions such as esterification, amide formation, and sulfonation.

About

CAS No 88-39-1
English Name 4-Formyl-1,3-benzenedisulfonic acid
Molecular Formula C7H6O7S2
Molecular Weight 266.25 g/mol
SMILES C1=CC(=C(C=C1S(=O)(=O)O)S(=O)(=O)O)C=O
InChIKey PQYVGRGYAZDHFY-UHFFFAOYSA-N
Last Updated: 2025-12-31 21:15

Related Q&A

Compound Q&A

How is 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1) typically synthesized?

4-Formyl-1,3-benzenedisulfonic acid is typically synthesized by the sulfonation of 1,3-benzenedicarb...

Compound Q&A

What industries use 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1)?

4-Formyl-1,3-benzenedisulfonic acid is used in various industries. It is a key component in the prod...

Compound Q&A

What precautions should be taken when handling 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1)?

When handling 4-Formyl-1,3-benzenedisulfonic acid (CAS: 88-39-1), appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...