Compound Q&A

How is 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) typically synthesized?

Answer

1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene
1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) can be synthesized via a multistep process starting from mesitylene. The process involves catalytic hydrogenation using a palladium catalyst followed by selective amination reactions. The reaction conditions and catalysts used are crucial for achieving high yield and selectivity.

About

CAS No 69441-16-3
English Name 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene
Molecular Formula C9D12
Molecular Weight 132.27 g/mol
SMILES [2H]c1c(c(c(c(c1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])[2H])C([2H])([2H])[2H]
InChIKey AUHZEENZYGFFBQ-ZPMNDIOMSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3)?

1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) is a crystalline compound with a molec...

Compound Q&A

What industries use 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3)?

1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3)?

When handling 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3), it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...