Compound Q&A

What are the physical and chemical properties of 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3)?

Answer

1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene
1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) is a crystalline compound with a molecular weight of approximately 256.31 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. This compound is highly reactive, particularly towards electrophilic substitution reactions. It is used in the synthesis of various functionalized derivatives and in the development of new materials.

About

CAS No 69441-16-3
English Name 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene
Molecular Formula C9D12
Molecular Weight 132.27 g/mol
SMILES [2H]c1c(c(c(c(c1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])[2H])C([2H])([2H])[2H]
InChIKey AUHZEENZYGFFBQ-ZPMNDIOMSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

How is 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) typically synthesized?

1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) can be synthesized via a multistep pro...

Compound Q&A

What industries use 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3)?

1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3)?

When handling 1,3,5-Tris[(~2~H_3_)methyl](~2~H_3_)benzene (CAS: 69441-16-3), it is essential to use ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...