Compound Q&A

How is 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) typically synthesized?

Answer

2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione
2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) is commonly synthesized via the condensation of 2,2-dimethyl-5-phenyl-1,3-dioxane with acetic anhydride in the presence of a strong acid catalyst such as concentrated sulfuric acid. The reaction involves the formation of an acyl intermediate and subsequent dehydration to yield the dione. The process typically has good yield and selectivity.

About

CAS No 15231-78-4
English Name 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione
Molecular Formula C12H12O4
Molecular Weight 220.224 g/mol
SMILES CC1(OC(=O)C(C(=O)O1)C2=CC=CC=C2)C
InChIKey NTUAHNQWHPQAMB-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4)?

2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) is a white crystalline solid with a mo...

Compound Q&A

What industries use 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4)?

2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4)?

When handling 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4), it is essential to wear...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...