Compound Q&A

What are the physical and chemical properties of 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4)?

Answer

2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione
2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) is a white crystalline solid with a molecular weight of approximately 282.27 g/mol. It has limited solubility in water but is more soluble in organic solvents such as ethanol, acetone, and dimethyl sulfoxide. The compound exhibits good stability under normal conditions but is reactive towards reducing agents. Its reactivity makes it useful in various organic synthesis reactions.

About

CAS No 15231-78-4
English Name 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione
Molecular Formula C12H12O4
Molecular Weight 220.224 g/mol
SMILES CC1(OC(=O)C(C(=O)O1)C2=CC=CC=C2)C
InChIKey NTUAHNQWHPQAMB-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:28

Related Q&A

Compound Q&A

How is 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) typically synthesized?

2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) is commonly synthesized via the conden...

Compound Q&A

What industries use 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4)?

2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4)?

When handling 2,2-Dimethyl-5-phenyl-1,3-dioxane-4,6-dione (CAS: 15231-78-4), it is essential to wear...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...