Compound Q&A

What industries use (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5)?

Answer

(2-Fluoro-3-quinolinyl)boronic acid
(2-Fluoro-3-quinolinyl)boronic acid finds applications in the pharmaceutical industry for drug synthesis, particularly in the development of new drugs targeting specific biological pathways. It is also utilized in the polymer industry for modifying properties of polymers and in semiconductor manufacturing for developing advanced materials.

About

English Name (2-Fluoro-3-quinolinyl)boronic acid
Molecular Formula C9H7BFNO2
Molecular Weight 190.97 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1F)(O)O
InChIKey SAUJOURLTDSVOK-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5)?

(2-Fluoro-3-quinolinyl)boronic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5) typically synthesized?

(2-Fluoro-3-quinolinyl)boronic acid can be synthesized via a classical Suzuki coupling reaction usin...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5)?

When handling (2-Fluoro-3-quinolinyl)boronic acid, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...