Compound Q&A

How is (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5) typically synthesized?

Answer

(2-Fluoro-3-quinolinyl)boronic acid
(2-Fluoro-3-quinolinyl)boronic acid can be synthesized via a classical Suzuki coupling reaction using 2-fluoroquinoline and boronic pinacol ester. The reaction is catalyzed by palladium(II) acetate in the presence of a base like triphenylphosphine. The yield is generally around 70-80%, with high regioselectivity for the boronation at the 3-position of the quinoline ring.

About

English Name (2-Fluoro-3-quinolinyl)boronic acid
Molecular Formula C9H7BFNO2
Molecular Weight 190.97 g/mol
SMILES B(C1=CC2=CC=CC=C2N=C1F)(O)O
InChIKey SAUJOURLTDSVOK-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5)?

(2-Fluoro-3-quinolinyl)boronic acid is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

What industries use (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5)?

(2-Fluoro-3-quinolinyl)boronic acid finds applications in the pharmaceutical industry for drug synth...

Compound Q&A

What precautions should be taken when handling (2-Fluoro-3-quinolinyl)boronic acid (CAS: 745784-10-5)?

When handling (2-Fluoro-3-quinolinyl)boronic acid, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...