Compound Q&A

How is 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) typically synthesized?

Answer

2,4-Dibromopyridine 1-oxide
2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) is typically synthesized by the reaction of 2,4-dibromopyridine with a suitable oxidizing agent, such as potassium permanganate or potassium dichromate, in an aqueous medium. The reaction is selective and yields the 1-oxide product with high purity. The yield is generally around 85-90%, depending on the purity of the starting material and the reaction conditions.

About

English Name 2,4-Dibromopyridine 1-oxide
Molecular Formula C5H3Br2NO
Molecular Weight 252.89 g/mol
SMILES C1=C[N+](=C(C=C1Br)Br)[O-]
InChIKey HLTHDBIDRZSXAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4)?

2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) is a solid with a crystalline form. Its molecular wei...

Compound Q&A

What industries use 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4)?

2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4)?

When handling 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...