Compound Q&A

What are the physical and chemical properties of 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4)?

Answer

2,4-Dibromopyridine 1-oxide
2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) is a solid with a crystalline form. Its molecular weight is approximately 270.04 g/mol. It has a low solubility in water but is more soluble in organic solvents such as dimethylformamide and acetonitrile. Chemically, it is less reactive than many other derivatives of pyridine due to the electron-withdrawing bromine atoms, which stabilize the positive charge on the nitrogen atom. It is stable under normal conditions but should be stored in a dry place away from moisture.

About

English Name 2,4-Dibromopyridine 1-oxide
Molecular Formula C5H3Br2NO
Molecular Weight 252.89 g/mol
SMILES C1=C[N+](=C(C=C1Br)Br)[O-]
InChIKey HLTHDBIDRZSXAV-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

How is 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) typically synthesized?

2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) is typically synthesized by the reaction of 2,4-dibro...

Compound Q&A

What industries use 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4)?

2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4) is used in the pharmaceutical industry for the synthe...

Compound Q&A

What precautions should be taken when handling 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4)?

When handling 2,4-Dibromopyridine 1-oxide (CAS: 117196-08-4), it is important to wear appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...