Compound Q&A

How is 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) typically synthesized?

Answer

1-Fluoro-3-(trichloromethyl)benzene
1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) is typically synthesized through the reaction of 3,5-dichlorobenzoyl chloride with fluorobenzene in the presence of a base such as sodium hydride. The reaction yields a high selectivity towards the desired product with good yield, although careful purification and handling are necessary.

About

CAS No 401-77-4
English Name 1-Fluoro-3-(trichloromethyl)benzene
Molecular Formula C7H4Cl3F
Molecular Weight 213.47 g/mol
SMILES C1=CC(=CC(=C1)F)C(Cl)(Cl)Cl
InChIKey JRTYPYSADXRJBQ-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4)?

1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4)?

1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) finds application in various industries, includi...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4)?

When handling 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...