Compound Q&A

What are the physical and chemical properties of 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4)?

Answer

1-Fluoro-3-(trichloromethyl)benzene
1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) is a crystalline solid with a molecular weight of approximately 246.48 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. This compound exhibits limited reactivity under normal conditions but can undergo substitution reactions under certain conditions. It is a potent chemical and should be handled with care.

About

CAS No 401-77-4
English Name 1-Fluoro-3-(trichloromethyl)benzene
Molecular Formula C7H4Cl3F
Molecular Weight 213.47 g/mol
SMILES C1=CC(=CC(=C1)F)C(Cl)(Cl)Cl
InChIKey JRTYPYSADXRJBQ-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

How is 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) typically synthesized?

1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) is typically synthesized through the reaction of...

Compound Q&A

What industries use 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4)?

1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4) finds application in various industries, includi...

Compound Q&A

What precautions should be taken when handling 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4)?

When handling 1-Fluoro-3-(trichloromethyl)benzene (CAS: 401-77-4), it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...