Compound Q&A

What industries use Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0)?

Answer

Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate
Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate is primarily used in the pharmaceutical industry for the synthesis of various drugs. It is also utilized in the polymer industry for the modification of polymers to enhance their properties. Additionally, it has applications in the development of sensors and semiconductors due to its unique chemical structure and reactivity.

About

English Name Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate
Molecular Formula C14H20N2O2
Molecular Weight 248.32599999999996 g/mol
SMILES CCOC(=O)C1CCN(CC1)C2=CC=C(C=C2)N
InChIKey JXCDVJXPSHIHLP-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0)?

Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate is a white crystalline solid with a molecular weight...

Compound Q&A

How is Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0) typically synthesized?

Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate is typically synthesized by a multistep process invo...

Compound Q&A

What precautions should be taken when handling Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0)?

When handling Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate, it is essential to use personal prote...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...