Compound Q&A

How is Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0) typically synthesized?

Answer

Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate
Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate is typically synthesized by a multistep process involving the condensation of ethyl 4-piperidinecarboxylate with 4-aminophenol. The synthesis often requires the use of a suitable catalyst, such as a base like sodium hydroxide, to promote the reaction. The yield is generally around 70-80%, and the method ensures good selectivity for the desired product.

About

English Name Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate
Molecular Formula C14H20N2O2
Molecular Weight 248.32599999999996 g/mol
SMILES CCOC(=O)C1CCN(CC1)C2=CC=C(C=C2)N
InChIKey JXCDVJXPSHIHLP-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0)?

Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate is a white crystalline solid with a molecular weight...

Compound Q&A

What industries use Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0)?

Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate (CAS: 439095-52-0)?

When handling Ethyl 1-(4-aminophenyl)-4-piperidinecarboxylate, it is essential to use personal prote...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...