Compound Q&A

What are the physical and chemical properties of 5-(tert-Butyl)-1H-indole (CAS: 92462-70-9)?

Answer

5-(tert-Butyl)-1H-indole
5-(tert-Butyl)-1H-indole (CAS: 92462-70-9) is a crystalline compound with a molecular weight of approximately 158.25 g/mol. Its solubility in water is low, but it is soluble in organic solvents like ethanol and acetone. Chemically, it is relatively stable but can react with strong acids and bases. It is often used as a starting material for organic synthesis due to its reactive heterocyclic structure.

About

CAS No 92462-70-9
English Name 5-(tert-Butyl)-1H-indole
Molecular Formula C12H15N
Molecular Weight 173.26 g/mol
SMILES CC(C)(C)C1=CC2=C(C=C1)NC=C2
InChIKey QXJXPMHKYYMECP-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

How is 5-(tert-Butyl)-1H-indole (CAS: 92462-70-9) typically synthesized?

5-(tert-Butyl)-1H-indole can be synthesized via the indole synthesis route, where tert-butyl chlorid...

Compound Q&A

What industries use 5-(tert-Butyl)-1H-indole (CAS: 92462-70-9)?

5-(tert-Butyl)-1H-indole (CAS: 92462-70-9) is primarily used in the pharmaceutical and polymer indus...

Compound Q&A

What precautions should be taken when handling 5-(tert-Butyl)-1H-indole (CAS: 92462-70-9)?

When handling 5-(tert-Butyl)-1H-indole (CAS: 92462-70-9), always wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...