Compound Q&A

What industries use Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1)?

Answer

Isopropyl (2,4-dichlorophenoxy)acetate
Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) is primarily used in the pharmaceutical industry for the synthesis of various intermediates and active pharmaceutical ingredients. It is also used in the polymer industry for the modification of polymer properties. Additionally, it has applications in the development of sensors and semiconductors due to its specific chemical reactivity.

About

CAS No 94-11-1
English Name Isopropyl (2,4-dichlorophenoxy)acetate
Molecular Formula C11H12Cl2O3
Molecular Weight 263.12 g/mol
SMILES CC(C)OC(=O)COc1ccc(cc1Cl)Cl
InChIKey WHOKDONDRZNCBC-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1)?

Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) is a colorless to slightly yellowish liquid. I...

Compound Q&A

How is Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) typically synthesized?

Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) is typically synthesized by the esterification...

Compound Q&A

What precautions should be taken when handling Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1)?

When handling Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1), it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...