Compound Q&A

What are the physical and chemical properties of Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1)?

Answer

Isopropyl (2,4-dichlorophenoxy)acetate
Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) is a colorless to slightly yellowish liquid. It has a molecular weight of approximately 234.07 g/mol. The compound is slightly soluble in water but miscible with common organic solvents like ethanol and acetone. It is stable under normal conditions but can react with strong bases. It has a low boiling point and is sensitive to light and air. It is commonly used in organic synthesis and pharmaceuticals.

About

CAS No 94-11-1
English Name Isopropyl (2,4-dichlorophenoxy)acetate
Molecular Formula C11H12Cl2O3
Molecular Weight 263.12 g/mol
SMILES CC(C)OC(=O)COc1ccc(cc1Cl)Cl
InChIKey WHOKDONDRZNCBC-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

How is Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) typically synthesized?

Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) is typically synthesized by the esterification...

Compound Q&A

What industries use Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1)?

Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1) is primarily used in the pharmaceutical indust...

Compound Q&A

What precautions should be taken when handling Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1)?

When handling Isopropyl (2,4-dichlorophenoxy)acetate (CAS: 94-11-1), it is important to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...