Compound Q&A

What industries use (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane) (CAS: 870718-97-1)?

Answer

(3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane)
The compound (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane) is primarily used in the pharmaceutical industry for the synthesis of certain drug intermediates. It is also relevant in the polymer industry for the preparation of specialized polymers and in the semiconductor industry for the development of advanced materials. Additionally, it may have applications in the sensor industry due to its unique chemical properties.

About

English Name (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane)
Molecular Formula C10H18F2SSn2
Molecular Weight 445.74 g/mol
SMILES FC1=C(SC(=C1F)[Sn](C)(C)C)[Sn](C)(C)C
InChIKey YQYNGODNRGLWSZ-UHFFFAOYSA-N
Last Updated: 2025-12-31 16:27

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane) (CAS: 870718-97-1)?

The compound (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane) is an organostannane derivative wit...

Compound Q&A

How is (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane) (CAS: 870718-97-1) typically synthesized?

This compound is typically synthesized via organometallic reaction methods, involving the coupling o...

Compound Q&A

What precautions should be taken when handling (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane) (CAS: 870718-97-1)?

When handling (3,4-Difluoro-2,5-thienediyl)bis(trimethylstannane), it is important to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...