Compound Q&A

How is Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5) typically synthesized?

Answer

Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate
Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate can be synthesized by the condensation of 2-(methoxyimino)acetic acid with 2-furaldehyde in the presence of a strong base such as sodium hydroxide. The reaction is carried out in an aqueous medium, and the product is isolated by acidification and recrystallization. The yield of the product is typically around 85%, and the reaction is highly selective.

About

CAS No 97148-89-5
English Name Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate
Molecular Formula C7H10N2O4
Molecular Weight 186.17 g/mol
SMILES CON=C(C1=CC=CO1)C(=O)[O-].[NH4+]
InChIKey ZWNSXPIVYODLLM-PHZXCRFESA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5)?

Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate is a crystalline compound with a molecular weigh...

Compound Q&A

What industries use Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5)?

Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5)?

When handling Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate, it is essential to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...