Compound Q&A

What are the physical and chemical properties of Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5)?

Answer

Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate
Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate is a crystalline compound with a molecular weight of approximately 246.24 g/mol. It has a solubility of 250 mg/mL in water and is slightly soluble in ethanol. The compound shows moderate reactivity towards nucleophiles, making it useful in various organic transformations. It has a melting point of 102-104°C and is stable under normal laboratory conditions.

About

CAS No 97148-89-5
English Name Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate
Molecular Formula C7H10N2O4
Molecular Weight 186.17 g/mol
SMILES CON=C(C1=CC=CO1)C(=O)[O-].[NH4+]
InChIKey ZWNSXPIVYODLLM-PHZXCRFESA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5) typically synthesized?

Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate can be synthesized by the condensation of 2-(met...

Compound Q&A

What industries use Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5)?

Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate (CAS: 97148-89-5)?

When handling Ammonium (Z)-2-(furan-2-yl)-2-(methoxyimino)acetate, it is essential to wear appropria...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...