Compound Q&A

What industries use 6-Phenyl-1H-indazole (CAS: 1260897-38-8)?

Answer

6-Phenyl-1H-indazole
6-Phenyl-1H-indazole is utilized in various industries, particularly in pharmaceuticals for its potential as a therapeutic agent. It is also used in the synthesis of dyes and pigments due to its vibrant color. In the polymer industry, it serves as a monomer or additive. Additionally, it finds applications in the manufacturing of sensors and semiconductors, where its electronic properties are exploited.

About

English Name 6-Phenyl-1H-indazole
Molecular Formula C13H10N2
Molecular Weight 194.24 g/mol
SMILES c1ccc(cc1)c2ccc3cn[nH]c3c2
InChIKey OPJICVPEFWXDDJ-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Phenyl-1H-indazole (CAS: 1260897-38-8)?

6-Phenyl-1H-indazole is a crystalline solid with a molecular weight of approximately 158.21 g/mol. I...

Compound Q&A

How is 6-Phenyl-1H-indazole (CAS: 1260897-38-8) typically synthesized?

6-Phenyl-1H-indazole can be synthesized via the indazole synthesis route, where phenylacetyl chlorid...

Compound Q&A

What precautions should be taken when handling 6-Phenyl-1H-indazole (CAS: 1260897-38-8)?

When handling 6-Phenyl-1H-indazole, it is important to use personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...