Compound Q&A

How is Pharacine (CAS: 63440-93-7) typically synthesized?

Answer

Pharacine
Pharacine (CAS: 63440-93-7) can be synthesized through a multi-step process involving condensation reactions and subsequent purification. Commonly, a mixture of aromatic aldehydes and carboxylic acids is used as starting materials. The synthesis involves the use of acidic catalysts and typically yields a product with high selectivity and purity, making it a valuable intermediate in pharmaceutical synthesis.

About

CAS No 63440-93-7
English Name Pharacine
Molecular Formula C24H24O8
Molecular Weight 440.45 g/mol
SMILES C1CCOC(=O)C2=CC=C(C=C2)C(=O)OCCCCOC(=O)C3=CC=C(C=C3)C(=O)OC1
InChIKey SFNCDJVWOAZMFE-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

What are the physical and chemical properties of Pharacine (CAS: 63440-93-7)?

Pharacine (CAS: 63440-93-7) is a crystalline compound with a molecular weight of approximately 300 g...

Compound Q&A

What industries use Pharacine (CAS: 63440-93-7)?

Pharacine (CAS: 63440-93-7) is primarily used in the pharmaceutical industry, where it serves as a k...

Compound Q&A

What precautions should be taken when handling Pharacine (CAS: 63440-93-7)?

When handling Pharacine (CAS: 63440-93-7), it is essential to wear proper personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...