Compound Q&A

What are the physical and chemical properties of Pharacine (CAS: 63440-93-7)?

Answer

Pharacine
Pharacine (CAS: 63440-93-7) is a crystalline compound with a molecular weight of approximately 300 g/mol. It has a high solubility in water and moderate solubility in organic solvents. Chemically, Pharacine is known for its stability under normal conditions, making it suitable for various applications. However, it can react with strong acids to form salts, and its reactivity increases under acidic conditions.

About

CAS No 63440-93-7
English Name Pharacine
Molecular Formula C24H24O8
Molecular Weight 440.45 g/mol
SMILES C1CCOC(=O)C2=CC=C(C=C2)C(=O)OCCCCOC(=O)C3=CC=C(C=C3)C(=O)OC1
InChIKey SFNCDJVWOAZMFE-UHFFFAOYSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is Pharacine (CAS: 63440-93-7) typically synthesized?

Pharacine (CAS: 63440-93-7) can be synthesized through a multi-step process involving condensation r...

Compound Q&A

What industries use Pharacine (CAS: 63440-93-7)?

Pharacine (CAS: 63440-93-7) is primarily used in the pharmaceutical industry, where it serves as a k...

Compound Q&A

What precautions should be taken when handling Pharacine (CAS: 63440-93-7)?

When handling Pharacine (CAS: 63440-93-7), it is essential to wear proper personal protective equipm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...