Compound Q&A

What are the physical and chemical properties of (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-Difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-N-ethyl-5-heptenamide (CAS: 1185851-52-8)?

Answer

(5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-Difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-N-ethyl-5-heptenamide
The compound is a crystalline solid with a molecular weight of approximately 414.4 g/mol. It has limited water solubility, making it suitable for organic synthesis. The compound is reactive towards nucleophiles and can undergo facile hydrolysis under basic conditions. It is stable under acidic conditions and requires storage in a dry, dark place to prevent degradation.

About

English Name (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-Difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-N-ethyl-5-heptenamide
Molecular Formula C24H33F2NO4
Molecular Weight 437.53 g/mol
SMILES CCNC(=O)CCC/C=C\C[C@H]1[C@@H](O)C[C@H]([C@@H]1/C=C/C(COc1ccccc1)(F)F)O
InChIKey VJZKLIPANASSBD-MSHHKXPZSA-N
Last Updated: 2025-12-31 11:48

Related Q&A

Compound Q&A

How is (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-Difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-N-ethyl-5-heptenamide (CAS: 1185851-52-8) typically synthesized?

The compound is synthesized through a multi-step process involving diaryliodonium salts and boronic ...

Compound Q&A

What industries use (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-Difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-N-ethyl-5-heptenamide (CAS: 1185851-52-8)?

This compound is primarily used in the pharmaceutical industry for developing novel drugs. It can al...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...