Compound Q&A

What industries use 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3)?

Answer

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride
3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is used in the pharmaceutical industry for the development of new drugs. It also finds applications in the synthesis of other chemical intermediates and in research for its potential use in electronic components and sensors.

About

English Name 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride
Molecular Formula C8H8BrClN2O2S
Molecular Weight 311.588 g/mol
SMILES C1=C(N=C2N1C=C(S2)Br)CCC(=O)O.Cl
InChIKey KMDHBXXAOXPFIC-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3)?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is a crystalline solid with a mole...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically synthesized by reacti...

Compound Q&A

What precautions should be taken when handling 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3)?

When handling 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride, it is important to ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...