Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7)?

Answer

2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate
2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate is used in the pharmaceutical industry for the synthesis of intermediates and drugs. It also finds applications in polymer chemistry for developing advanced materials, and in the manufacturing of sensors due to its unique chemical properties.

About

English Name 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate
Molecular Formula C14H20BrN3O2
Molecular Weight 342.24 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)c2cccc(n2)Br
InChIKey CQSAPHUUCUUHNS-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7)?

2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate is a crystalline solid with a mo...

Compound Q&A

How is 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7) typically synthesized?

2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate is commonly synthesized via a mu...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7)?

When handling 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate, it is crucial to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...