Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7)?

Answer

2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate
2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate is a crystalline solid with a molecular weight of approximately 333.11 g/mol. It is moderately soluble in common organic solvents like DMSO and dichloromethane. This compound is known for its chemical stability and reactivity towards nucleophiles, making it suitable for various synthetic transformations.

About

English Name 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate
Molecular Formula C14H20BrN3O2
Molecular Weight 342.24 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC1)c2cccc(n2)Br
InChIKey CQSAPHUUCUUHNS-UHFFFAOYSA-N
Last Updated: 2025-12-31 06:49

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7) typically synthesized?

2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate is commonly synthesized via a mu...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7)?

2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate (CAS: 331767-56-7)?

When handling 2-Methyl-2-propanyl 4-(6-bromo-2-pyridinyl)-1-piperazinecarboxylate, it is crucial to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...