Compound Q&A

What are the main uses of 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0)?

Answer

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole
5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole is primarily used as a pharmaceutical intermediate. It plays a role in the synthesis of other organic compounds and is also employed in various chemical research applications. Its specific uses include the development of new drugs and materials.

About

English Name 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole
Molecular Formula C15H13FN4O2S
Molecular Weight 332.36 g/mol
SMILES c1ccc(cc1)n2c(nnn2)S(=O)(=O)CCc3ccc(cc3)F
InChIKey IDDVKAPYSSGYSK-UHFFFAOYSA-N
Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What is 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0)?

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole is a chemical compound with a CAS number...

Compound Q&A

Is 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0) safe?

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole is generally considered safe for industr...

Compound Q&A

How should 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0) be stored?

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole should be stored in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...