Compound Q&A

What is 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0)?

Answer

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole
5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole is a chemical compound with a CAS number of 1370411-43-0. It is a complex organic molecule with a tetrazole ring structure, characterized by its sulfur-containing functional groups and aromatic rings. This compound is typically colorless or white crystalline solid with a melting point around 210-212°C.

About

English Name 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole
Molecular Formula C15H13FN4O2S
Molecular Weight 332.36 g/mol
SMILES c1ccc(cc1)n2c(nnn2)S(=O)(=O)CCc3ccc(cc3)F
InChIKey IDDVKAPYSSGYSK-UHFFFAOYSA-N
Last Updated: 2025-12-31 02:27

Related Q&A

Compound Q&A

What are the main uses of 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0)?

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole is primarily used as a pharmaceutical in...

Compound Q&A

Is 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0) safe?

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole is generally considered safe for industr...

Compound Q&A

How should 5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole (CAS: 1370411-43-0) be stored?

5-{[2-(4-Fluorophenyl)ethyl]sulfonyl}-1-phenyl-1H-tetrazole should be stored in a cool, dry place, a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...