Compound Q&A

How should 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0) be stored?

Answer

9,9'-Spirobi[fluoren]-4-ylboronic acid
9,9'-Spirobi[fluoren]-4-ylboronic acid should be stored in a cool, dry place, protected from moisture and light. It should be kept in a tightly sealed container to prevent degradation. Avoid storing in high humidity or direct sunlight, as these conditions can affect the stability of the compound. It is recommended to store in a desiccator if long-term storage is required.

About

English Name 9,9'-Spirobi[fluoren]-4-ylboronic acid
Molecular Formula C25H17BO2
Molecular Weight 360.22 g/mol
SMILES OB(C1=CC=CC(C23C4=C(C5=C3C=CC=C5)C=CC=C4)=C1C6=C2C=CC=C6)O
InChIKey NOTKALFQBCUAKB-UHFFFAOYSA-N
Last Updated: 2025-12-30 13:38

Related Q&A

Compound Q&A

What is 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0)?

9,9'-Spirobi[fluoren]-4-ylboronic acid is a boronic acid derivative with a spirobi[fluoren] backbone...

Compound Q&A

What are the main uses of 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0)?

9,9'-Spirobi[fluoren]-4-ylboronic acid is primarily used in organic synthesis, particularly in Suzuk...

Compound Q&A

Is 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0) safe?

9,9'-Spirobi[fluoren]-4-ylboronic acid is considered generally safe for laboratory use when proper h...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...