Compound Q&A

What are the main uses of 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0)?

Answer

9,9'-Spirobi[fluoren]-4-ylboronic acid
9,9'-Spirobi[fluoren]-4-ylboronic acid is primarily used in organic synthesis, particularly in Suzuki coupling reactions. It also finds applications in materials science, where it contributes to the development of novel functional materials. Additionally, it is explored in the field of catalysis and as a potential reagent in various chemical transformations.

About

English Name 9,9'-Spirobi[fluoren]-4-ylboronic acid
Molecular Formula C25H17BO2
Molecular Weight 360.22 g/mol
SMILES OB(C1=CC=CC(C23C4=C(C5=C3C=CC=C5)C=CC=C4)=C1C6=C2C=CC=C6)O
InChIKey NOTKALFQBCUAKB-UHFFFAOYSA-N
Last Updated: 2025-12-30 13:38

Related Q&A

Compound Q&A

What is 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0)?

9,9'-Spirobi[fluoren]-4-ylboronic acid is a boronic acid derivative with a spirobi[fluoren] backbone...

Compound Q&A

Is 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0) safe?

9,9'-Spirobi[fluoren]-4-ylboronic acid is considered generally safe for laboratory use when proper h...

Compound Q&A

How should 9,9'-Spirobi[fluoren]-4-ylboronic acid (CAS: 1421789-05-0) be stored?

9,9'-Spirobi[fluoren]-4-ylboronic acid should be stored in a cool, dry place, protected from moistur...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...