Compound Q&A

What is Telavancin HCl (CAS: 560130-42-9)?

Answer

Telavancin HCl
Telavancin HCl is a semisynthetic lipoglycopeptide antibiotic. It is primarily known for its activity against Gram-positive bacteria, particularly those resistant to other antibiotics. Telavancin HCl has a unique chemical structure that includes a polyene skeleton with a hydroxyethylamine side chain, making it effective in treating various infections.

About

English Name Telavancin HCl
Molecular Formula C80H107Cl3N11O27P
Molecular Weight 1792.1 g/mol
SMILES ClC1C=C2[C@H]([C@H]3C(N[C@H](C(=O)O)C4C=C(C(CNCP(=O)(O)O)=C(C=4C4=C(C=CC(=C4)[C@H](C(N3)=O)NC([C@H]3C4=CC(=C(C(=C4)OC=1C=C2)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)O[C@H]1C[C@@](C)([C@@H]([C@H](C)O1)O)NCCNCCCCCCCCCC)OC1C=CC([C@H]([C@H](C(N[C@@H](CC(N)=O)C(N3)=O)=O)NC([C@@H](CC(C)C)NC)=O)O)=CC=1Cl)=O)O)O)O)=O)O.Cl
InChIKey GSSIWSIRBWAZHG-ACOPVEIWSA-N
Last Updated: 2025-12-30 13:38

Related Q&A

Compound Q&A

What are the main uses of Telavancin HCl (CAS: 560130-42-9)?

Telavancin HCl is mainly used in the treatment of hospital-acquired pneumonia and complicated skin a...

Compound Q&A

Is Telavancin HCl (CAS: 560130-42-9) safe?

Telavancin HCl is considered generally safe when used under the guidance of a healthcare professiona...

Compound Q&A

How should Telavancin HCl (CAS: 560130-42-9) be stored?

Telavancin HCl should be stored at 2-8°C (36-46°F) in a refrigerator. It should be protected from li...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...