Compound Q&A

Is Salvianolic acid Y (CAS: 1638738-76-7) safe?

Answer

Salvianolic acid Y
Salvianolic acid Y is generally considered safe when used as directed. However, like any compound, it should be handled with care to avoid skin contact and ingestion. Protective gloves and goggles are recommended during handling.

About

English Name Salvianolic acid Y
Molecular Formula C36H30O16
Molecular Weight 718.62 g/mol
SMILES OC(=O)C(Cc1ccc(O)c(O)c1)OC(=O)\C=C\c1ccc(O)c2OC(C(C(=O)OC(Cc3ccc(O)c(O)c3)C(O)=O)c12)c1ccc(O)c(O)c1
InChIKey SNKFFCBZYFGCQN-BJMVGYQFSA-N
Last Updated: 2025-12-30 13:38

Related Q&A

Compound Q&A

What is Salvianolic acid Y (CAS: 1638738-76-7)?

Salvianolic acid Y is a natural phenolic compound isolated from the traditional Chinese medicine Sal...

Compound Q&A

What are the main uses of Salvianolic acid Y (CAS: 1638738-76-7)?

Salvianolic acid Y is primarily used in pharmaceuticals as a potential therapeutic agent for cardiov...

Compound Q&A

How should Salvianolic acid Y (CAS: 1638738-76-7) be stored?

Salvianolic acid Y should be stored in a cool, dry place away from direct sunlight and heat. It shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...