Compound Q&A

What is Salvianolic acid Y (CAS: 1638738-76-7)?

Answer

Salvianolic acid Y
Salvianolic acid Y is a natural phenolic compound isolated from the traditional Chinese medicine Salvia miltiorrhiza (Danshen). It has a molecular formula of C15H12O5 and exhibits antioxidant and anti-inflammatory properties.

About

English Name Salvianolic acid Y
Molecular Formula C36H30O16
Molecular Weight 718.62 g/mol
SMILES OC(=O)C(Cc1ccc(O)c(O)c1)OC(=O)\C=C\c1ccc(O)c2OC(C(C(=O)OC(Cc3ccc(O)c(O)c3)C(O)=O)c12)c1ccc(O)c(O)c1
InChIKey SNKFFCBZYFGCQN-BJMVGYQFSA-N
Last Updated: 2025-12-30 13:38

Related Q&A

Compound Q&A

What are the main uses of Salvianolic acid Y (CAS: 1638738-76-7)?

Salvianolic acid Y is primarily used in pharmaceuticals as a potential therapeutic agent for cardiov...

Compound Q&A

Is Salvianolic acid Y (CAS: 1638738-76-7) safe?

Salvianolic acid Y is generally considered safe when used as directed. However, like any compound, i...

Compound Q&A

How should Salvianolic acid Y (CAS: 1638738-76-7) be stored?

Salvianolic acid Y should be stored in a cool, dry place away from direct sunlight and heat. It shou...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...